Identification |
Name: | 2-Propenoic acid,3-phenyl-, 4-[(aminocarbonyl)amino]phenyl ester |
Synonyms: | Cinnamicacid, ester with (p-hydroxyphenyl)urea (8CI); Cinnamic acid, p-ureidophenylester (6CI); Urea, (p-hydroxyphenyl)-, cinnamate (8CI); Cinnapyrine; Elbon;O-Cinnamoyl-p-hydroxyphenylurea |
CAS: | 539-09-3 |
EINECS: | 208-709-9 |
Molecular Formula: | C16H14 N2 O3 |
Molecular Weight: | 282.29396 |
InChI: | InChI=1/C16H14N2O3/c17-16(20)18-13-7-9-14(10-8-13)21-15(19)11-6-12-4-2-1-3-5-12/h1-11H,(H3,17,18,20)/b11-6+ |
Molecular Structure: |
 |
Properties |
Flash Point: | 238.8°C |
Boiling Point: | 471.2°Cat760mmHg |
Density: | 1.305g/cm3 |
Refractive index: | 1.678 |
Flash Point: | 238.8°C |
Safety Data |
|
 |