| Identification | |
| Name: | Ethyl levulinate |
| Synonyms: | FEMA No. 2442;Ethyl ketovalerate;Ethyl levulate;Ethyl 4-oxopentanoate;Levulinic acid, ethyl ester;Ethyl laevulinate;Ethyl 4-oxovalerate;Ethyl levulinate (natural);Ethyl 4-ketovalerate;Ethyl 3-acetylpropionate;4-03-00-01562 (Beilstein Handbook Reference);Ethyl acetylpropanoate;Ethyl-4-oxovalerate;Pentanoic acid, 4-oxo-, ethyl ester; |
| CAS: | 539-88-8 |
| EINECS: | 208-728-2 |
| Molecular Formula: | C7H12O3 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C7H12O3/c1-3-10-7(9)5-4-6(2)8/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kg in |
| Density: | 1.012 |
| Refractive index: | 1.421-1.423 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | clear to yellowish liquid |
| Specification: | clear yellowish liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29183000 |
| Safety Data | |
| Hazard Symbols |
6.1 (Packing Group: III)
UN
NO.
|
 |
|
