| Identification | |
| Name: | 2-Imidazolidinone,1-acetyl- |
| Synonyms: | N-Acetyl-2-imidazolidinone; |
| CAS: | 5391-39-9 |
| EINECS: | 226-388-3 |
| Molecular Formula: | C5H8N2O2 |
| Molecular Weight: | 128.12922 |
| InChI: | InChI=1S/C5H8N2O2/c1-4(8)7-3-2-6-5(7)9/h2-3H2,1H3,(H,6,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.237 |
| Refractive index: | 1.492 |
| Water Solubility: | Soluble in methanol |
| Solubility: | Soluble in methanol |
| Appearance: | White to off-white powder |
| Specification: |
1-Acetylimidazolidine-2-thione , its CAS NO. is 5391-39-9, the synonym is 1-Acetyl-2-imidazolidinone . |
| Flash Point: | °C |
| Safety Data | |
 |
|
