| Identification |
| Name: | 1H-Isoindole-1,3(2H)-dione,2-(4-bromobutyl)- |
| Synonyms: | Phthalimide,N-(4-bromobutyl)- (7CI);1-Phthalimido-4-bromobutane;2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione;2-(4-Bromobutyl)isoindole-1,3-dione;2-(4-Bromobutyl)isoindoline-1,3-dione;2-(4-Bromobutyl)phthalimide;4-Bromobutylphthalimide;N-(4-Bromobutyl)phthalimide;NSC 575; |
| CAS: | 5394-18-3 |
| EINECS: | 226-401-2 |
| Molecular Formula: | C12H12BrNO2 |
| Molecular Weight: | 282.14 |
| InChI: | InChI=1/C12H12BrNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,3-4,7-8H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.513 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.602 |
| Water Solubility: | soluble in ethanol |
| Solubility: | soluble in ethanol |
| Appearance: | Off-white powder |
| HS Code: | 29251995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
