| Identification | |
| Name: | 2-Propenoic acid,3-(3,4-dimethoxyphenyl)-, methyl ester |
| Synonyms: | Cinnamicacid, 3,4-dimethoxy-, Me ester (4CI);Cinnamic acid, 3,4-dimethoxy-, methylester (6CI,7CI,8CI);3,4-O-Dimethylcaffeic acid methyl ester;3-(3,4-Dimethoxyphenyl)-2-propenoic acid methyl ester;Methyl3,4-dimethoxycinnamate;NSC 4331; |
| CAS: | 5396-64-5 |
| Molecular Formula: | C12H14O4 |
| Molecular Weight: | 222.24 |
| InChI: | InChI=1/C12H14O4/c1-14-10-6-4-9(8-11(10)15-2)5-7-12(13)16-3/h4-8H,1-3H3/b7-5+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 63-65?C |
| Density: | 1.12 g/cm3 |
| Refractive index: | 1.536 |
| Appearance: | White Solid |
| Specification: |
2-Propenoic acid,3-(3,4-dimethoxyphenyl)-, methyl ester , its cas register number is 5396-64-5. It also can be called 3,4-O-Dimethylcaffeic acid methyl ester ; AI3-23964 ; Methyl 3,4-dimethoxycinnamate ; and Methyl 3,4-dimethyoxycinnamate . |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
