| Identification |
| Name: | Butanoic acid, 3-oxo-,phenylmethyl ester |
| Synonyms: | Acetoaceticacid, benzyl ester (6CI,8CI);3-Oxobutanoic acid benzyl ester;3-Oxobutanoicacid phenylmethyl ester;Benzyl 3-oxobutanoate;Benzyl acetoacetate;Benzylacetylacetate;NSC 4391;Phenylmethyl 3-oxobutanoate; |
| CAS: | 5396-89-4 |
| EINECS: | 226-416-4 |
| Molecular Formula: | C11H12O3 |
| Molecular Weight: | 192.21448 |
| InChI: | InChI=1/C11H12O3/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.115 g/cm3 |
| Refractive index: | n20/D 1.512(lit.) |
| Water Solubility: | insoluble in water; soluble in organic solvents, oils |
| Solubility: | insoluble in water; soluble in organic solvents, oils |
| Appearance: | clear colorless to yellow liquid |
| Usage: | Benzyl acetoacetate (AAbenzyl) is chemical intermediate used for the syntheses of different organic chemicals Product Data Sheet |
| Safety Data |
| |
 |
