| Identification |
| Name: | Propanedioic acid,2-(3-methylbutyl)-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, isopentyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid,(3-methylbutyl)-, diethyl ester (9CI);(3-Methylbutyl)propanedioic acid diethylester;Diethyl 2-isopentylmalonate;Diethyl 3-methylbutylmalonate;Diethylisoamylmalonate;Diethyl isopentylmalonate;NSC 4569; |
| CAS: | 5398-08-3 |
| EINECS: | 226-424-8 |
| Molecular Formula: | C12H22O4 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C12H22O4/c1-5-15-11(13)10(8-7-9(3)4)12(14)16-6-2/h9-10H,5-8H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 6 |
| Flash Point: | 109.8°C |
| Density: | 0.982g/cm3 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.4240 (20 C) |
| Solubility: | Insoluble |
| Appearance: | Liquid. |
| Flash Point: | 109.8°C |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data |
| |
 |
