| Identification | |
| Name: | Benzenamine,2,6-diiodo-4-nitro- |
| Synonyms: | Aniline,2,6-diiodo-4-nitro- (6CI,7CI,8CI); 2,6-Diiodo-4-nitroaniline;2,6-Diiodo-4-nitrobenzenamine; 2,6-Diiodo-p-nitroaniline;4-Nitro-2,6-diiodoaniline; NSC 4606 |
| CAS: | 5398-27-6 |
| EINECS: | 226-429-5 |
| Molecular Formula: | C6H4 I2 N2 O2 |
| Molecular Weight: | 389.92 |
| InChI: | InChI=1/C18H18N2/c1-12-5-4-6-13(11-12)17-18-15(9-10-19-17)14-7-2-3-8-16(14)20-18/h2-8,11,17,19-20H,9-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 251-253 °C(lit.) |
| Flash Point: | 214.4°C |
| Boiling Point: | 430.8°Cat760mmHg |
| Density: | 2.639g/cm3 |
| Refractive index: | 1.661 |
| Specification: | yellow to green crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 214.4°C |
| Safety Data | |
 |
|
