Identification |
Name: | 1H-Indole-5,6-dione,2,3-dihydro-3-hydroxy-1-methyl- |
Synonyms: | 5,6-Indolinedione,3-hydroxy-1-methyl- (8CI);1-Methyl-3-hydroxy-5,6-dioxo-2,3,5,6-tetrahydroindole; 2,3-Dihydro-3-hydroxy-N-methylindole-5,6-quinone;3-Hydroxy-1-methyl-5,6-indolinedione; Adraxone; Adrenochrome |
CAS: | 54-06-8 |
EINECS: | 200-192-8 |
Molecular Formula: | C9H9 N O3 |
Molecular Weight: | 179.19 |
InChI: | InChI=1/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3/t9-/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 180.7°C |
Boiling Point: | 375.1°C at 760 mmHg |
Density: | 1.42g/cm3 |
Refractive index: | 1.63 |
Specification: | Red Crystalline Solid usageEng:The substance mainly responsible for the red colours produced during the mild oxidation of adrenaline Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 180.7°C |
Storage Temperature: | −20°C |
Usage: | The substance mainly responsible for the red colours produced during the mild oxidation of adrenaline |
Safety Data |
|
 |