| Identification | |
| Name: | DL-Tryptophan |
| Synonyms: | Tryptophan, DL-(8CI);Racemic tryptophan;1H-Indole-3-alanine;DL-Tryptophane;DL-a-Amino-3-indolepropionic acid;NSC 13118;CCRIS 719;UNII-X9U7434L7A;AI3-24395;DL-alpha-Amino-3-indolepropionic acid;(+-)-Tryptophan; |
| CAS: | 54-12-6 |
| EINECS: | 200-194-9 |
| Molecular Formula: | C11H12N2O2 |
| Molecular Weight: | 204.23 |
| InChI: | InChI=1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.362 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Solubility: | 10 g/L (20 ºC) in water |
| Appearance: | white or off-white powder or crystals |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| HS Code: | 29339990 |
| Storage Temperature: | Store at RT. |
| Usage: | The d form is one of the 20 standard amino acids, as well as an essential amino acid in the human diet. |
| Safety Data | |
 |
|
