| Identification | |
| Name: | pyridoxal 5'-phosphate |
| Synonyms: | Pyridoxalphosphate (6CI);Pyridoxal, 5-(dihydrogen phosphate) (8CI);2-Methyl-3-hydroxy-4-formyl-5-pyridylmethylphosphoricacid;3-Hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde 5-phosphate;Apolon B6;Biosechs;Codecarboxylase;Coenzyme B6;Hairoxal;Hexermin P;Hi-Pyridoxin;Hiadelon;NSC 82388;PAL-P; |
| CAS: | 54-47-7 |
| EINECS: | 200-208-3 |
| Molecular Formula: | C8H10NO6P |
| Molecular Weight: | 247.16 |
| InChI: | InChI=1/C8H9NO3.H3O4P/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-5(2,3)4/h2,4,10,12H,3H2,1H3;(H3,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 140-143 oC |
| Density: | 1.638g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | Light yellow powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | -20oC |
| Usage: | Active form of vitamin b 6 serving as a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid. |
| Safety Data | |
 |
|
