| Identification | |
| Name: | 1,5-Pentamethylenetetrazole |
| Synonyms: | 6,7,8,9-Tetrahydro-5H-tetrazoloazepine; Pentylenetetrazole~6,7,8,9-Tetrahydro-5H-tetrazoloazepine; pentetrazol; leptazol; 1,5-Pentamethylene-1H-tetrazole; Pentylenetetrazole; Pentertrazol |
| CAS: | 54-95-5 |
| EINECS: | 200-219-3 |
| Molecular Formula: | C6H10N4 |
| Molecular Weight: | 138.17 |
| InChI: | InChI=1/C6H10N4/c1-2-4-6-7-8-9-10(6)5-3-1/h1-5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.73 g/cm3 (20 C) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.494 (20 C) |
| Water Solubility: | >=10 g/100 mL at 21 C |
| Solubility: | substantial
|
| Appearance: | white crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Biological Activity: | CNS stimulant that induces kindling in vivo . Causes alterations in excitatory and inhibitory neurotransmitter systems. |
| Storage Temperature: | −20°C |
| Sensitive: | Hygroscopic |
| Usage: | Analeptic. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
