| Identification | |
| Name: | Benzenamine,4-iodo- |
| Synonyms: | Aniline,p-iodo- (6CI,8CI);1-Iodo-4-aminobenzene;4-Iodobenzenamine;4-Iodobenzeneamine;4-Iodophenylamine;NSC 9246;p-Aminoiodobenzene;p-Aminophenyl iodide;p-Iodoaniline;4-Iodo-phenylamine; |
| CAS: | 540-37-4 |
| EINECS: | 208-743-4 |
| Molecular Formula: | C6H6IN |
| Molecular Weight: | 219.02 |
| InChI: | InChI=1/C6H6IN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 116.3 ºC |
| Boiling Point: | 268.7 ºC at 760 mmHg |
| Density: | 1.924 g/cm3 |
| Refractive index: | 1.688 |
| Appearance: | off-white crystalline powder |
| Specification: | beige to greyish-brown crystalline powder usageEng:suzuki reaction Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Flash Point: | 116.3 ºC |
| Sensitive: | Light Sensitive |
| Usage: | suzuki reaction |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
