| Identification |
| Name: | 1H-Inden-1-ol,2-bromo-2,3-dihydro- |
| Synonyms: | 1-Indanol,2-bromo- (6CI,7CI); 2-Bromo-1-indanol; NSC 10389 |
| CAS: | 5400-80-6 |
| EINECS: | 226-442-6 |
| Molecular Formula: | C9H9 Br O |
| Molecular Weight: | 213.07 |
| InChI: | InChI=1/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 146.3°C |
| Boiling Point: | 318.3°Cat760mmHg |
| Density: | 1.64g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.657 |
| Appearance: | White to off-white crystalline powder. |
| Flash Point: | 146.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
