| Identification | |
| Name: | 5-Thiazolecarbonylchloride, 4-methyl-2-phenyl- |
| Synonyms: | 5-(Chlorocarbonyl)-4-methyl-2-phenyl-1,3-thiazole; |
| CAS: | 54001-18-2 |
| Molecular Formula: | C11H8ClNOS |
| Molecular Weight: | 237.71 |
| InChI: | InChI=1/C11H8ClNOS/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Melting Point: | 122 °C |
| Flash Point: | 178.6°C |
| Boiling Point: | 371.8°Cat760mmHg |
| Density: | 1.319g/cm3 |
| Refractive index: | 1.609 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 178.6°C |
| Safety Data | |
 |
|
