Identification |
Name: | 5-Nitroindazole |
Synonyms: | 5-Nitro-1H-indazole; 5-Nitroindazoles |
CAS: | 5401-94-5 |
EINECS: | 226-451-5 |
Molecular Formula: | C7H5N3O2 |
Molecular Weight: | 163.13 |
InChI: | InChI=1/C7H5N3O2/c11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-4H,(H,8,9) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs
|
Density: | 1.525 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.74 |
Solubility: | Insoluble |
Appearance: | yellow to green
crystals |
HS Code: | 29339990 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |