| Identification | |
| Name: | 9H-Purine,6-hydrazinyl- |
| Synonyms: | 6H-Purin-6-one,1,7-dihydro-, hydrazone (9CI); Purine, 6-hydrazino- (6CI,7CI,8CI);6-Hydrazino-1H-purine; 6-Hydrazinopurine; NSC 7354 |
| CAS: | 5404-86-4 |
| Molecular Formula: | C5H6 N6 |
| Molecular Weight: | 150.14 |
| InChI: | InChI=1/C5H6N6/c6-11-5-3-4(8-1-7-3)9-2-10-5/h1-3H,6H2,(H,7,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150.14 |
| Density: | 1.702 g/cm3 |
| Refractive index: | 1.982 |
| Appearance: | White to light yellow crystalline powder |
| Specification: |
6-Hydrazinopurine (5404-86-4) also can be called for 6-Hydrazinyl-9H-purine ; 6-hydrazino-1H-purine ; 6H-purin-6-one, 1,7-dihydro-, hydrazone, (6E)- ; 9H-purine, 6-hydrazinyl- . |
| Safety Data | |
 |
|
