| Identification | |
| Name: | Ethyl 3-hydroxybutyrate |
| CAS: | 5405-41-4 |
| EINECS: | 226-456-2 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.15 |
| InChI: | InChI=1/C6H12O3/c1-3-9-6(8)4-5(2)7/h5,7H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2394 |
| Density: | 1.01 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4195-1.415 |
| Appearance: | clear colorless liquid |
| Specification: |
Ethyl 3-hydroxybutyrate (CAS NO.5405-41-4) is also named as AI3-11592 ; Butanoic acid, 3-hydroxy-, ethyl ester ; Butyric acid, 3-hydroxy-, ethyl ester ; Ethyl 3-hydroxybutanoate ; Ethyl 3-hydroxybutyrate (natural) ; Ethyl beta-hydroxybutyrate ; FEMA No. 3428 ; NSC 42916 ; NSC 8115 . Ethyl 3-hydroxybutyrate (CAS NO.5405-41-4) is clear colorless liquid. It is soluble in water. Ethyl 3-hydroxybutyrate is incompatible with strong oxidizing agents and strong bases. It is combustible. |
| HS Code: | 29181980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
