| Identification | |
| Name: | 2,7-Dinitrofluorene |
| Synonyms: | - |
| CAS: | 5405-53-8 |
| EINECS: | 226-457-8 |
| Molecular Formula: | C13H8N2O4 |
| Molecular Weight: | 256.21 |
| InChI: | InChI=1/C13H8N2O4/c16-14(17)10-1-3-12-8(6-10)5-9-7-11(15(18)19)2-4-13(9)12/h1-4,6-7H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 41524 |
| Density: | 1.489 g/cm3 |
| Refractive index: | 1.705 |
| Appearance: | light yellow powder |
| Specification: |
2,7-Dinitrofluorene (5405-53-8) is a yellow powder and it should be used only by those trained in handling potentially hazardous materials. Moreover, it should store in tightly sealed containers in a cool place. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
