Cyclopropanecarboxamidine hydrochloride (54070-74-5)

The Cyclopropanecarboxamidine hydrochloride with its cas register number is 54070-74-5. It also can be called as Cyclopropanecarboxamidine Acetic Acid and the IUPAC Name about this chemical is cyclopropanecarboximidamide hydrochloride. It belongs to the following product categories, such as Amidine, pharmacetical and so on.

Physical properties about Cyclopropanecarboxamidine hydrochloride are: (1)ACD/LogP: -0.93; (2)ACD/LogD (pH 5.5): -2.93; (3)ACD/LogD (pH 7.4): -2.93; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 2; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 15.6Ų; (12)Surface Tension: dyne/cm; (13)Enthalpy of Vaporization: 37.11 kJ/mol; (14)Vapour Pressure: 8.42 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CC1C(=N)N.Cl
(2)InChI: InChI=1S/C4H8N2.ClH/c5-4(6)3-1-2-3;/h3H,1-2H2,(H3,5,6);1H 
(3)InChIKey: JRYOZJIRAVZGMV-UHFFFAOYSA-N