| Identification | |
| Name: | 9H-Cyclopenta[1,2-b:4,3-b']dipyridin-9-one |
| Synonyms: | 1,8-Diaza-9-fluorenone;1,8-Diazafluorenone;9H-1,8-Diazafluoren-9-one; |
| CAS: | 54078-29-4 |
| Molecular Formula: | C11H6N2O |
| Molecular Weight: | 182.18 |
| InChI: | InChI=1/C11H6N2O/c14-11-9-7(3-1-5-12-9)8-4-2-6-13-10(8)11/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.387g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.688 |
| Appearance: | yellow powder |
| Specification: |
1,8-Diazafluoran-9-one , its CAS NO. is 54078-29-4, the synonyms are Dfo ; Cyclopenta[1,2-b:4,3-b']dipyridin-9-one ; 4-5-Diazafluorenone-0 ; Rarechem aq nn 0271 ; 1,8-Diaza-9-fluorenone ; 2.1,8-Diazafluoran-9-one . |
| Safety Data | |
 |
|
