| Identification | |
| Name: | Butane, 1,1-dichloro- |
| Synonyms: | 1,1-Dichlorobutane;Butylidene chloride |
| CAS: | 541-33-3 |
| EINECS: | 208-775-9 |
| Molecular Formula: | C4H8 Cl2 |
| Molecular Weight: | 127.02 |
| InChI: | InChI=1S/C4H8Cl2/c1-2-3-4(5)6/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 18.3°C |
| Boiling Point: | 114.8°Cat760mmHg |
| Density: | 0.83g/cm3 |
| Specification: |
Butylidene chloride (541-33-3) also can be called Butane, 1,1-dichloro- ; 1,1-Dichlorobutane ; Dichlorobutane and Butane, dichloro- .When with case of fire, high temperature, strong oxidant, it is combustible; high-temperature will make it to be decompounted to toxic chlorine gas. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 18.3°C |
| Safety Data | |
 |
|
