Identification |
Name: | Butanamide |
Synonyms: | Butyramide(6CI,8CI);Butanimidic acid;NSC 8424;n-Butylamide;n-Butyramide; |
CAS: | 541-35-5 |
EINECS: | 208-776-4 |
Molecular Formula: | C4H9NO |
Molecular Weight: | 87.12 |
InChI: | InChI=1/C4H9NO/c1-2-3-4(5)6/h2-3H2,1H3,(H2,5,6) |
Molecular Structure: |
|
Properties |
Flash Point: | 87.9 °C |
Density: | 1.032 |
Refractive index: | 1.42 |
Water Solubility: | soluble |
Solubility: | soluble IN Water |
Appearance: | clear liquid |
Specification: | COLORLESS TO WHITE CRYSTALLINE POWDER OR FLAKES Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
HS Code: | 29241900 |
Flash Point: | 87.9 °C |
Color: | Crystals LEAVES FROM BENZENE |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|