| Identification | |
| Name: | Maleimide |
| Synonyms: | 2,5-Pyrroledione; 2,5-Dioxo-3-pyrroline~1H-Pyrrole-2,5-dione; 3-Pyrroline-2,5-dione; Maleic imide; maleicimide; Maleinimide; MALEIC ACID IMIDE; ASISCHEM S97810; 1h-pyrrole-2,5-dione; PYRROLE-2,5-DIONE; Maleimide, 98+%; 2,5-dioxo-3-pyrroline; 1H-Pyrrole-2,5-dione,2,5-Pyrroledione |
| CAS: | 541-59-3 |
| EINECS: | 208-787-4 |
| Molecular Formula: | C4H3NO2 |
| Molecular Weight: | 97.07 |
| InChI: | InChI=1/C4H3NO2/c6-3-1-2-4(7)5-3/h1-2H,(H,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 |
| Flash Point: | 136.6°C |
| Boiling Point: | 97-103°C 5mm |
| Density: | 97 |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | slight yellow crystalline powder |
| Specification: | slight yellow crystalline powder usageEng:Rhodium-catalyzed conjugate arylation with arylboronic acids.1 Safety Statements:26-36/37/39-45-37/39-28A-7/9 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection 7/9:Keep container tightly closed and in a well-ventilated place |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29251995 |
| Flash Point: | 136.6°C |
| Storage Temperature: | Refrigerator |
| Usage: | Rhodium-catalyzed conjugate arylation with arylboronic acids.1 |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
