| Identification | |
| Name: | Cyclopentadecanone,3-methyl- |
| Synonyms: | Muscone(6CI);Moschus ketone;Muskone;dl-Muscone; |
| CAS: | 541-91-3 |
| EINECS: | 208-795-8 |
| Molecular Formula: | C16H30O |
| Molecular Weight: | 238.41 |
| InChI: | InChI=1S/C16H30O/c1-15-12-10-8-6-4-2-3-5-7-9-11-13-16(17)14-15/h15H,2-14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 33 C |
| Flash Point: | >110 C |
| Boiling Point: | 130 C at 0.3 mmHg |
| Density: | 0.843 g/cm3 |
| Water Solubility: | Insoluble (soluble in alcohol) |
| Solubility: | Insoluble (soluble in alcohol) Appearance:white to yellowish semi-solid Transport Information:OTH Hazard Symbols:UN NO. particular:particular |
| Appearance: | white to yellowish semi-solid |
| Flash Point: | >110 C |
| Color: | YELLOW |
| Safety Data | |
| Hazard Symbols | |
 |
|
