| Identification | |
| Name: | p-Dioxane-2,6-dimethanol |
| Synonyms: | 1,4-Dioxane-2,6-dimethanol;Bis(2,6-hydroxymethyl)dioxane(Mixture of Diastereomers);p-Dioxane-2,6-dimethanol;1,4-Dioxane-2,6-bismethanol |
| CAS: | 54120-69-3 |
| Molecular Formula: | C6H12O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H12O4/c7-1-5-3-9-4-6(2-8)10-5/h5-8H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.7°C |
| Boiling Point: | 294.2°C at 760 mmHg |
| Density: | 1.178g/cm3 |
| Refractive index: | 1.455 |
| Specification: | Yellow Oil usageEng:Used for preparation of antidiabetic agents comprising antiinflammatory or analgesic drugs |
| Flash Point: | 131.7°C |
| Storage Temperature: | -20?C Freezer |
| Usage: | Used for preparation of antidiabetic agents comprising antiinflammatory or analgesic drugs |
| Safety Data | |
 |
|
