| Identification | |
| Name: | Pyrimidine,4-chloro-5-ethyl- |
| Synonyms: | 4-chloro-5-ethyl-pyrimidine;4-Chlor-5-ethylpyrimidin;pyrimidine, 4-chloro-5-ethyl-; |
| CAS: | 54128-01-7 |
| Molecular Formula: | C6H7ClN2 |
| Molecular Weight: | 142.59 |
| InChI: | InChI=1/C6H7ClN2/c1-2-5-3-8-4-9-6(5)7/h3-4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 98.9°C |
| Boiling Point: | 207.9°Cat760mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.523 |
| Specification: |
The 4-Chloro-5-ethylpyrimidine, with the cas registry number 54128-01-7, has the systematic name and IUPAC name of 4-chloro-5-ethylpyrimidine. It belongs to the product category of Pyrimidine. And the molecular formula of the chemical is C6H7ClN2. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.78; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.78; (4)ACD/LogD (pH 7.4): 0.78; (5)ACD/BCF (pH 5.5): 2.305; (6)ACD/BCF (pH 7.4): 2.305; (7)ACD/KOC (pH 5.5): 63.27; (8)ACD/KOC (pH 7.4): 63.271; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 25.78 Å2; (13)Index of Refraction: 1.523; (14)Molar Refractivity: 36.88 cm3; (15)Molar Volume: 120.649 cm3; (16)Polarizability: 14.62×10-24cm3; (17)Surface Tension: 42.492 dyne/cm; (18)Density: 1.182 g/cm3; (19)Flash Point: 98.939 °C; (20)Enthalpy of Vaporization: 42.602 kJ/mol; (21)Boiling Point: 207.886 °C at 760 mmHg; (22)Vapour Pressure: 0.317 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 98.9°C |
| Safety Data | |
 |
|
