| Identification | |
| Name: | 4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-, 6-acetate |
| Synonyms: | 4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-, acetate (9CI); 4,7-Methanoinden-6-ol, 3a,4,5,6,7,7a-hexahydro-,acetate (6CI,8CI); 4,7-Methano-3a,4,5,6,7,7a-hexahydroinden-6-yl acetate;8-Acetoxytricyclo[5.2.1.02,6]dec-3-ene; Greenyl acetate; Herbaflorat;Jasmacyclene; NSC 6598; Verdyl acetate |
| CAS: | 5413-60-5 |
| EINECS: | 226-501-6 |
| Molecular Formula: | C12H16 O2 |
| Molecular Weight: | 192.25 |
| InChI: | InChI=1/C12H16O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h2-3,8-12H,4-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.12 g/cm3 |
| Refractive index: | 1.536 |
| Water Solubility: | insoluble in water, soluble in oils and organic solvents |
| Solubility: | insoluble in water, soluble in oils and organic solvents |
| Appearance: | colorless to pale yellow clear liquid |
| Specification: |
Dihydronordicyclopentadienyl acetate ,its CAS NO. is 5413-60-5,the synonyms is Tricyclodecenyl acetate ; Verdyl acetate ; 3a,4,5,6,7,7a-Hexahydro-4,7-methanoinden-6-ylacetate ; 4,7-Methano-1h-inden-6-ol, 3a,4,5,6,7,7a-hexahydro-, acetate ; 4,7-Methano-1h-inden-6-ol,3a,4,5,6,7,7a-hexahydro-,acetate ; 4,7-Methanoinden-6-ol, 3a,4,5,6,7,7a-hexahydro-, acetate ; 7-Methano-1h-inden-6-ol,3a,4,5,6,7,7a-hexahydro-acetate ; 7-Methanoinden-6-ol,3a,4,5,6,7,7a-hexahydro-acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
