| Identification | |
| Name: | 5-Amino-4,6-dichloropyrimidine |
| Synonyms: | 5-Pyrimidinamine, 4,6-dichloro-;4,6-Dichloro-5-aminopyrimidine;Pyrimidine, 5-amino-4,6-dichloro-;4,6-dichloropyrimidin-5-amine;4,6-Dichloropyrimidin-5-ylamine; |
| CAS: | 5413-85-4 |
| EINECS: | 226-503-7 |
| Molecular Formula: | C4H3Cl2N3 |
| Molecular Weight: | 163.99 |
| InChI: | InChI=1/C4H3Cl2N3/c5-3-2(7)4(6)9-1-8-3/h1H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.606 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.633 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | straw yellow solid |
| Specification: | Yellowish-brown crystals or powder usageEng:An intermediate in the production of many biological inhibitors. Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29335995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Usage: | An intermediate in the production of many biological inhibitors. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
