| Identification | |
| Name: | Benzenamine,2,4-dimethoxy-, hydrochloride (1:1) |
| Synonyms: | Benzenamine,2,4-dimethoxy-, hydrochloride (9CI); 2,4-Dimethoxyaniline hydrochloride;2,4-Dimethoxybenzenamine hydrochloride |
| CAS: | 54150-69-5 |
| Molecular Formula: | C8H11 N O2 . Cl H |
| Molecular Weight: | 189.66 |
| InChI: | InChI=1/C8H11NO2.ClH/c1-10-6-3-4-7(9)8(5-6)11-2;/h3-5H,9H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 230 °C (dec.)(lit.) |
| Flash Point: | 124.8°C |
| Boiling Point: | 267.1°Cat760mmHg |
| Density: | 1.096g/cm3 |
| Specification: | Safety Statements:26-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 124.8°C |
| Safety Data | |
 |
|
