| Identification | |
| Name: | Ethanimidamide,2-hydroxy-, hydrochloride (1:1) |
| Synonyms: | Ethanimidamide,2-hydroxy-, monohydrochloride (9CI); Glycolamidine, hydrochloride (7CI);2-Hydroxyacetamidine hydrochloride; Hydroxyacetamidine hydrochloride |
| CAS: | 54198-71-9 |
| Molecular Formula: | C2H6 N2 O . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C2H6N2O.ClH/c3-2(4)1-5;/h5H,1H2,(H3,3,4);1H/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 67°C |
| Boiling Point: | 187.2°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Specification: |
The 2-Hydroxyethanimidamide monohydrochloride, with the CAS registry number 54198-71-9, has the systematic name of 2-hydroxyethanimidamide hydrochloride (1:1). And the molecular formula of the chemical is C2H6N2O.HCl. Uses of 2-Hydroxyethanimidamide monohydrochloride: It can react with 1-dimethylamino-3-dimethylimonio-2-phenyl-prop-1-ene tetrafluoroborate to produce 2-hydroxymethyl-5-phenylpyrimidine. This reaction will need reagent 2M sodium methoxyde, and the menstruum methanol. The reaction time is 2 hours with heating, and the yield is about 80%. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 67°C |
| Safety Data | |
 |
|
