| Identification | |
| Name: | 6-methyl-1,3,5-triazine-2,4-diyldiamine |
| Synonyms: | 2,4-amino-6-methyl-1,3,5-triazine; 6-Methyl-1,3,5-triazine-2,4-diamine |
| CAS: | 542-02-9 |
| EINECS: | 208-796-3 |
| Molecular Formula: | C4H7N5 |
| Molecular Weight: | 125.13188 |
| InChI: | InChI=1S/C4H7N5/c1-2-7-3(5)9-4(6)8-2/h1H3,(H4,5,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 252 ºC |
| Boiling Point: | 443ºC at 760 mmHg |
| Density: | 1.391 g/cm3 |
| Stability: | Stable. Incompatible with oxidizing agents, acids. |
| Refractive index: | 1.675 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white crystalline powder |
| Specification: | white solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 252 ºC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
