Identification |
Name: | 6-methyl-1,3,5-triazine-2,4-diyldiamine |
Synonyms: | 2,4-amino-6-methyl-1,3,5-triazine; 6-Methyl-1,3,5-triazine-2,4-diamine |
CAS: | 542-02-9 |
EINECS: | 208-796-3 |
Molecular Formula: | C4H7N5 |
Molecular Weight: | 125.13188 |
InChI: | InChI=1S/C4H7N5/c1-2-7-3(5)9-4(6)8-2/h1H3,(H4,5,6,7,8,9) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Flash Point: | 252 ºC |
Boiling Point: | 443ºC at 760 mmHg |
Density: | 1.391 g/cm3 |
Stability: | Stable. Incompatible with oxidizing agents, acids. |
Refractive index: | 1.675 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | white crystalline powder |
Specification: | white solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 252 ºC |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |