| Identification | |
| Name: | glycerol 1-palmitate |
| Synonyms: | Palmitoyl glycerol;(+-)-2,3-Dihydroxypropyl hexadecanoate;1-Monopalmitoylglycerol;1-Palmitoylglycerol;Glycerol 1-monopalmitate;Glycerol 1-palmitate;Glycerol 3-palmitate;NSC 404240;Palmitic acid alpha-monoglyceride;alpha-Monopalmitin;(1)-2,3-Dihydroxypropyl palmitate;2,3-Dihydroxypropyl palmitate;Palmitin, 1-mono- (8CI) |
| CAS: | 542-44-9 |
| EINECS: | 208-812-9;243-218-3 |
| Molecular Formula: | C19H38O4 |
| Molecular Weight: | 330.50 |
| InChI: | InChI=1/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 75 °C |
| Flash Point: | 146.7°C |
| Boiling Point: | 451.3°Cat760mmHg |
| Density: | 0.969g/cm3 |
| Specification: | White Solid usageEng:A biomarker of metabolic responses to hepatotoxicants and carcinogens. |
| Flash Point: | 146.7°C |
| Storage Temperature: | −20°C |
| Usage: | A biomarker of metabolic responses to hepatotoxicants and carcinogens. |
| Safety Data | |
 |
|
