| Identification | ||
| Name: | Nitrous acid,2-methylpropyl ester | |
| Synonyms: | Isobutylnitrite (6CI,7CI);Nitrous acid, isobutyl ester (8CI);iso-Butylnitrite;Blackjack; | |
| CAS: | 542-56-3 | |
| EINECS: | 208-819-7 | |
| Molecular Formula: | C4H9NO2 | |
| Molecular Weight: | 103.12 | |
| InChI: | InChI=1/C4H9NO2/c1-4(2)3-7-5-6/h4H,3H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2351 3/PG 2 | |
| Density: | 0.87 | |
| Stability: | Stable. Incompatible with acids, alcohols, strong bases. Decomposes slowly in water. Flammable - incompatible with strong oxidizing agents. Note wide explosion limits. May be light and moisture sensitive. Oxidizer. May explode if heated. | |
| Refractive index: | 1.37-1.375 | |
| Water Solubility: | <0.1 g/100 mL (19 ºC) | |
| Solubility: | <0.1 g/100 mL (19 oC) | |
| Appearance: | colourless to pale yellow liquid | |
| Specification: | colourless to pale yellow liquid Safety Statements:53-45 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) | |
| Packinggroup: | II | |
| Storage Temperature: | 0-6°C | |
| Sensitive: | Light Sensitive/Air Sensitive | |
| Color: | COLORLESS LIQUID | |
| Safety Data | ||
| Hazard Symbols |
F:Flammable
|
|
 |
||
