| Identification | |
| Name: | 1,2-Ethanediol,1-acetate |
| Synonyms: | 1,2-Ethanediol,monoacetate (9CI); Ethylene glycol, monoacetate (7CI,8CI); 2-Acetoxyethanol;2-Hydroxyethyl acetate; Ethylenediol monoacetate; Glycol monoacetate;Monoacetyl ethylene glycol; NSC 9234; b-Hydroxyethyl acetate |
| CAS: | 542-59-6 |
| EINECS: | 208-821-8 |
| Molecular Formula: | C4H8 O3 |
| Molecular Weight: | 104.12 |
| InChI: | InChI=1/C4H8O3/c1-4(6)7-3-2-5/h5H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -61.7 |
| Density: | 1.089g/cm3 |
| Refractive index: | n20/D 1.42(lit.) |
| Specification: |
2-Hydroxyethyl acetate with CAS number of 542-59-6 is also named as1,2-Ethanediol, monoacetate ; 1,2-Ethanediol,monoacetate ; 1,2-Ethanediolmonoacetate ; 2-Acetoxyethanol ; 2-Hydroxyethyl ester of acetic acid ; 2-Hydroxyethylester kyseliny octove ; 2-Hydroxyethylesterkyselinyoctove ; beta-Hydroxyethyl acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Safety Data | |
 |
|
