| Identification | |
| Name: | 1,5-Naphthyridin-4-ol |
| Synonyms: | 4-Hydroxy-1,5-naphthyridine;NSC 13205 |
| CAS: | 5423-54-1 |
| Molecular Formula: | C8H6 N2 O |
| Molecular Weight: | 146.15 |
| InChI: | InChI=1/C8H6N2O/c11-7-3-5-9-6-2-1-4-10-8(6)7/h1-5H,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.267g/cm3 |
| Refractive index: | 1.705 |
| Specification: |
The 4-Hydroxy-1,5-naphthyridine with the CAS number 5423-54-1 is also called 1,5-Naphthyridin-4-ol. The systematic name is 1,5-naphthyridin-4(1H)-one . Its molecular formula is C8H6N2O. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.83; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 46.01 Å2; (11)Index of Refraction: 1.705; (12)Molar Refractivity: 42.16 cm3; (13)Molar Volume: 108.427 cm3; (14)Polarizability: 16.713×10-24cm3; (15)Surface Tension: 70.708 dyne/cm; (16)Enthalpy of Vaporization: 59.83 kJ/mol; (17)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
