| Identification | |
| Name: | 1,2,4-Benzotriazin-3-amine,1-oxide |
| Synonyms: | 1,2,4-Benzotriazine,3-amino-, 1-oxide (6CI,7CI,8CI); 3-Amino-1,2,4-benzotriazine 1-oxide;4-Desoxytirapazamine; SR 4317; Win 64012 |
| CAS: | 5424-06-6 |
| EINECS: | 226-559-2 |
| Molecular Formula: | C7H6 N4 O |
| Molecular Weight: | 162.15 |
| InChI: | InChI=1/C7H8N4O/c8-7-9-5-3-1-2-4-6(5)11(12)10-7/h1-4,12H,(H3,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189.2°C |
| Boiling Point: | 389.3°C at 760 mmHg |
| Density: | 1.6g/cm3 |
| Refractive index: | 1.769 |
| Specification: | Yellow Solid usageEng:An intermediate in the synthesis of Tirapazamine, a bioreductive anticancer agent. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 189.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | An intermediate in the synthesis of Tirapazamine, a bioreductive anticancer agent. |
| Safety Data | |
 |
|
