| Identification | |
| Name: | 2,4-Dichloro-6-methylpyrimidine |
| Synonyms: | - |
| CAS: | 5424-21-5 |
| EINECS: | 226-563-4 |
| Molecular Formula: | C5H4Cl2N2 |
| Molecular Weight: | 163.01 |
| InChI: | InChI=1/C5H4Cl2N2/c1-3-2-4(6)9-5(7)8-3/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3263 |
| Density: | 1.404 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.551 |
| Solubility: | Slightly soluble |
| Appearance: | light yellow prismatic crystal |
| Specification: |
Pyrimidine, 2,4-dichloro-6-methyl- , with CAS number of 5424-21-5, can be called 2,4-Dichlor-6-methylpyrimidin ; 2,4-Dichloro-6-méthylpyrimidine ; 2,6-Dichloro-4-methylpyrimidine . It is a white to light yellow powder. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
