Identification |
Name: | 1,10-Phenanthrolin-5-amine |
Synonyms: | 5-Amino-1,10-phenanthroline;Amino-1,1,0-phenanthroline;(1,10)Phenanthrolin-5-ylamine; |
CAS: | 54258-41-2 |
Molecular Formula: | C12H9N3 |
Molecular Weight: | 195.22 |
InChI: | InChI=1/C12H9N3/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,13H2 |
Molecular Structure: |
|
Properties |
Density: | 1.333g/cm3 |
Refractive index: | 1.796 |
Specification: |
1,10-Phenanthrolin-5-amine (CAS NO.54258-41-2), its Synonyms are Amino-1,1,0-phenanthroline ; (1,10)Phenanthrolin-5-ylamine ; 5-Amino-1,10-phenanthroline .
|
Usage: | 1,10-Phenanthrolin-5-amine is a potential fluorescent label for DNA detection. 1,10-Phenanthrolin-5-amine is used as a mediator for glucose oxidase for development of biosensors and biofuel cells |
Safety Data |
|
|