| Identification |
| Name: | 1-phenylbiguanide, compound with benzothiazole-2(3H)-thione (1:1) |
| Synonyms: | Imidodicarbonimidic diamide, N-phenyl-, compd. with 2(3H)-benzothiazolethione (1:1);NSC 8174;Phenylbiguanide mbt-salt;1-Phenylbiguanide, compound with benzothiazole-2(3H)-thione (1:1);Biguanide, 1-phenyl-, compd. with 2-benzothiazolethiol (1:1) (8CI);1-(diaminomethylidene)-2-phenylguanidine - 1,3-benzothiazole-2(3H)-thione (1:1) |
| CAS: | 5437-11-6 |
| EINECS: | 226-607-2 |
| Molecular Formula: | C15H16N6S2 |
| Molecular Weight: | 344.4577 |
| InChI: | InChI=1/C8H11N5.C7H5NS2/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;9-7-8-5-3-1-2-4-6(5)10-7/h1-5H,(H6,9,10,11,12,13);1-4H,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 188.7°C |
| Boiling Point: | 388.4°C at 760 mmHg |
| HS Code: | 2934999090 |
| Flash Point: | 188.7°C |
| Safety Data |
| |
 |
