| Identification | |
| Name: | Acetic acid, 2-bromo-,phenylmethyl ester |
| Synonyms: | Aceticacid, bromo-, benzyl ester (6CI,7CI,8CI);Acetic acid, bromo-, phenylmethylester (9CI);Benzyl bromoacetate;Bromoacetic acidbenzyl ester;Merbac 35;NSC 16114;NSC 23980;Phenylmethyl bromoacetate; |
| CAS: | 5437-45-6 |
| EINECS: | 226-611-4 |
| Molecular Formula: | C9H9BrO2 |
| Molecular Weight: | 229.07 |
| InChI: | InChI=1/C9H9BrO2/c10-6-9(11)12-7-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.446 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.543-1.545 |
| Solubility: | Insoluble |
| Appearance: | Colorless or light yellow liquid |
| Specification: |
?Acetic acid, bromo-, benzyl ester , its CAS NO. is 5437-45-6, the synonyms are? 4-06-00-02265 (Beilstein Handbook Reference) ; AI3-18917 ; Acetic acid, bromo-, phenylmethyl ester ; BRN 0973658 ; Benzyl 2-bromoacetate ; Benzyl bromoacetate ; Caswell No. 082A ; EINECS 226-611-4 ; EPA Pesticide Chemical Code 008710 ; Merbac 35 . |
| HS Code: | 29159080 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
