| Identification | |
| Name: | 2-Amino-1,4-naphthoquinone imine hydrochloride |
| Synonyms: | 2-Amino-1,4-naphthoquinone imine;1(4H)-NAPHTHALENONE, 2-AMINO-4-IMINO-;2-Amino-4-imino-1(4H)-naphthalenone;BRN 2830840;NSC15013;AC1L2IMV;5438-85-7;1(4H)-Naphthalenone der.;2-amino-4-iminonaphthalen-1-one;5438-85-7 (mono-hydrochloride);1,4-Naphthoquinone imine, 2-amino-;20513-06-8;LS-95028 |
| CAS: | 5438-85-7 |
| Molecular Formula: | C10H8N2O . ClH |
| Molecular Weight: | 172.18332 |
| InChI: | InChI=1S/C10H8N2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,11H,12H2 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
2-Amino-1,4-naphthoquinone imine hydrochloride ,its cas register number is 5438-85-7. It also can be called 1(4H)-Naphthalenone, 2-amino-4-imino-, monohydrochloride ;and 2-Amino-4-imino-1(4H)-naphthalenone hydrochloride . 2-Amino-1,4-naphthoquinone imine hydrochloride (CAS NO.5438-85-7) is drug and therapeutic agent. |
| Safety Data | |
 |
|
