| Identification | |
| Name: | Phenol,4-[(2-nitrophenyl)amino]- |
| Synonyms: | 4'-Hydroxy-2-nitrodiphenylamine;HC Orange 1; HC Orange No. 1; N-(4-Hydroxyphenyl)-2-nitroaniline |
| CAS: | 54381-08-7 |
| EINECS: | 259-132-4 |
| Molecular Formula: | C12H10 N2 O3 |
| Molecular Weight: | 230.22 |
| InChI: | InChI=1/C12H10N2O3/c15-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(16)17/h1-8,13,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 186.6 |
| Boiling Point: | 384.9 ºC at 760 mmHg |
| Density: | 1.388 g/cm3 |
| Refractive index: | 1.699 |
| Appearance: | Orange crystal powder |
| Specification: |
Phenol,4-[(2-nitrophenyl)amino]- with cas registry number of 54381-08-7 is also called 2-Nitro-4'-hydroxydiphenylamine ; 4-((2-Nitrophenyl)amino)phenol ; HC Orange no. 1 ; p-((o-Nitrophenyl)amino)phenol . |
| Flash Point: | 186.6 |
| Safety Data | |
 |
|
