Identification |
Name: | Benzenamine,2-nitro-4-(propylthio)- |
Synonyms: | 2-Nitro-4-(propylthio)aniline;[2-Nitro-4-(propylthio)phenyl]amine |
CAS: | 54393-89-4 |
EINECS: | 259-142-9 |
Molecular Formula: | C9H12 N2 O2 S |
Molecular Weight: | 212.27 |
InChI: | InChI=1/C9H12N2O2S/c1-2-5-14-7-3-4-8(10)9(6-7)11(12)13/h3-4,6H,2,5,10H2,1H3 |
Molecular Structure: |
![(C9H12N2O2S) 2-Nitro-4-(propylthio)aniline;[2-Nitro-4-(propylthio)phenyl]amine](https://img.guidechem.com/casimg/54393-89-4.gif) |
Properties |
Flash Point: | 173.6 ºC |
Boiling Point: | 363.5 ºC |
Density: | 1.25 g/cm3 |
Refractive index: | 1.607 |
Appearance: | light yellow solid powder |
Specification: |
2-Nitro-4-(Propylthio)Aniline (54393-89-4), which also can be called for 2-Nitro-4-(Propylthio)Aniline ; 2-Nitro-4-(Propylthio)Benzenamine . 2-Nitro-4-(Propylthio)Aniline (54393-89-4) can be used for the intermediate of Albendazole manufacturing.
|
Flash Point: | 173.6 ºC |
Safety Data |
|
 |