Identification |
Name: | Butane,1,1'-oxybis[3-methyl- |
Synonyms: | Isopentyl ether(6CI,7CI,8CI);Di-3-methylbutyl ether;Diisoamyl ether;Diisopentyl ether;Isoamyl ether;Isoamyl oxide;NSC 9281; |
CAS: | 544-01-4 |
EINECS: | 208-857-4 |
Molecular Formula: | C10H22O |
Molecular Weight: | 158.28 |
InChI: | InChI=1/C10H22O/c1-9(2)5-7-11-8-6-10(3)4/h9-10H,5-8H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3271 |
Melting Point: | -75 |
Density: | 0.778 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.407-1.409 |
Water Solubility: | insoluble |
Solubility: | insoluble in water |
Appearance: | Colorless transparent liquid |
Packinggroup: | III |
HS Code: | 29091900 |
Storage Temperature: | Flammables area |
Color: | COLORLESS LIQUID |
Usage: | Solvent in grignard reaction, also as solvent of odorous principles, manufacture lacquers, regenerating rubber. |
Safety Data |
|
 |