| Identification |
| Name: | Hexadecanamide,N-(2-hydroxyethyl)- |
| Synonyms: | (Hydroxyethyl)palmitamide;2-(Palmitoylamino)ethanol;2-Palmitamidoethanol;AM 3112;Impulsin;Loramine P256;N-(2-Hydroxyethyl)hexadecanamide;N-(2-Hydroxyethyl)palmitamide;N-Hexadecanoylethanolamine;N-Palmitoylethanolamine;NSC 23320;Palmidrol;Palmitic acid monoethanolamide;Palmitic monoethanolamide;Palmitoylethanolamide; |
| CAS: | 544-31-0 |
| EINECS: | 208-867-9 |
| Molecular Formula: | C18H37NO2 |
| Molecular Weight: | 299.49188 |
| InChI: | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20/h20H,2-17H2,1H3,(H,19,21) |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.91 g/cm3 |
| Refractive index: | 1.462 |
| Appearance: | White solid. |
| Biological Activity: | Endogenous lipid that acts as a selective GPR55 agonist (EC 50 values are 4, 19 800 and > 30 000 nM at GPR55, CB 2 and CB 1 receptors respectively). Substrate for fatty acid amide hydrolase (FAAH) and PEA-preferring acid amidase (PAA) and exhibits antinociceptive and anticonvulsant in vivo . Directly activates PPAR α (EC 50 = 3 μ M) producing robust anti-inflammatory actions. |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
