| Identification | |
| Name: | 3-Octadecoxypropane-1,2-diol |
| Synonyms: | (RS)-Batylalcohol;1-O-Octadecylglycerol;1-Octadecyloxy-2,3-dihydroxypropane;Batilalcohol;Glycerol 1-octadecyl ether;NikkolBatyl Alcohol 100;Nikkol Batyl Alcohol EX;Stearylmonoglyceride;a-Monostearyl glyceryl ether; |
| CAS: | 544-62-7 |
| EINECS: | 208-874-7 |
| Molecular Formula: | C21H44O3 |
| Molecular Weight: | 344.65 |
| InChI: | InChI=1/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3/t21-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.914g/cm3 |
| Refractive index: | 1.464 |
| Solubility: | Insoluble |
| Specification: |
3-Octadecoxypropane-1,2-diol , with CAS number of 51-74-1, can be called 1,2-Propanediol, 3- (octadecyloxy)- ; 3-(Octadecyloxy)-1,2-propandiol ; 3-(Octadecyloxy)propane-1,2-diol ; Batylol ; (+)-Batylalcohol ; .alpha.-Octadecylether of glycerol . 3-Octadecoxypropane-1,2-diol (CAS NO.544-62-7) is one of the commonly used drugs promoted the proliferation of white blood cell proliferation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | -15°C |
| Usage: | Emollient. |
| Safety Data | |
 |
|
