| Identification | |
| Name: | Carbamimidothioic acid,C,C'-1,3-propanediyl ester, hydrobromide (1:2) |
| Synonyms: | Carbamimidothioicacid, 1,3-propanediyl ester, dihydrobromide (9CI); Pseudourea,2,2'-trimethylenebis[2-thio-, dihydrobromide (7CI,8CI) |
| CAS: | 5442-32-0 |
| EINECS: | 226-635-5 |
| Molecular Formula: | C5H12 N4 S2 . 2 Br H |
| Molecular Weight: | 354.17 |
| InChI: | InChI=1/C5H12N4S2.2BrH/c6-4(7)10-2-1-3-11-5(8)9;;/h1-3H2,(H3,6,7)(H3,8,9);2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161.7°C |
| Boiling Point: | 343.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Propane diisothiourea dihydrobromide , its cas register number is 5442-32-0. It also can be called 2,2'-Trimethylenebis(2-thiopseudourea) dihydrobromide ; AI3-62287 ; EINECS 226-635-5 ; NSC 12755 Pseudourea, 2,2'-trimethylenebis(2-thio-, dihydrobromide ; Pseudourea, 2,2'-trimethylenedithiodi-, dihydrobromide ; Pseudourea, propanebis(2'-thio-, dihydrobromide . When heated to decomposition it emits very toxic fumes of HBr, SOx, and NOx. Wear suitable protective clothing and gloves when contact with Propane diisothiourea dihydrobromide (CAS NO.5442-32-0). |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 161.7°C |
| Safety Data | |
 |
|
