| Identification | |
| Name: | 2-Propenal,2-bromo-3-phenyl- |
| Synonyms: | Cinnamaldehyde,a-bromo- (6CI,7CI,8CI);2-Bromo-3-phenylacrolein;Alphabrocine;B 36;B 37;NSC19806;a-Bromocinnamic aldehyde; |
| CAS: | 5443-49-2 |
| EINECS: | 226-637-6 |
| Molecular Formula: | C9H7BrO |
| Molecular Weight: | 211.06 |
| InChI: | InChI=1/C9H7BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-7H/b9-6- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.499g/cm3 |
| Refractive index: | 1.627 |
| Appearance: | light yellow to ochre crystalline powder |
| Specification: |
?2-Bromocinnamaldehyde , its cas register number is 5443-49-2. It also can be called 2-Propenal,2-bromo-3-phenyl- ;?Bromocinnamal ; alpha-Bromocinnamaldehyde?; 2-Bromo-3-phenyl-2-propenal ; 2-Bromocinnamaldehyde ; 2-Propenal, 2-bromo-3-phenyl- (9CI) ; Cinnamaldehyde, alpha-bromo- .It is a?light yellow to ochre crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
