| Identification | |
| Name: | Propanoic acid,2-bromo-, methyl ester |
| Synonyms: | Propionicacid, 2-bromo-, methyl ester (7CI,8CI);2-Bromopropanoicacid methyl ester;DL-a-Bromopropionic acid methylester;Methyl 2-bromopropanoate;Methyl DL-2-bromopropanoate;Methyl DL-a-bromopropionate;Methyl a-bromopropionate;NSC 21973; |
| CAS: | 5445-17-0 |
| EINECS: | 226-642-3 |
| Molecular Formula: | C4H7BrO2 |
| Molecular Weight: | 167 |
| InChI: | InChI=1/C4H7BrO2/c1-3(5)4(6)7-2/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.497 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4509-1.453 |
| Water Solubility: | Immiscible |
| Solubility: | Immiscible |
| Appearance: | Clear colourless to slightly yellow liquid |
| Specification: |
Propanoic acid, 2-bromo-, methyl ester , its cas register number is 5445-17-0. It also can be called Methyl 2-bromopropionate ; Methyl alpha-bromopropionate .It is a clear colourless to slightly yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
